C27H32ClN3O4 — CID 100695662
(2R)-N-[(2S)-butan-2-yl]-2-[(2-chlorophenyl)methyl-[4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]butanamide (PubChem CID 100695662) has the molecular formula C27H32ClN3O4 and a molecular weight of 498.02 g/mol. Its IUPAC name is (2R)-N-[(2S)-butan-2-yl]-2-[(2-chlorophenyl)methyl-[4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]butanamide.
| Compound Name | (2R)-N-[(2S)-butan-2-yl]-2-[(2-chlorophenyl)methyl-[4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 100695662 |
| Molecular Formula | C27H32ClN3O4 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (2R)-N-[(2S)-butan-2-yl]-2-[(2-chlorophenyl)methyl-[4-(1,3-dioxoisoindol-2-yl)butanoyl]amino]butanamide |
| SMILES | CC[C@H](C(=O)N[C@@H](C)CC)N(Cc1ccccc1Cl)C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H32ClN3O4/c1-4-18(3)29-25(33)23(5-2)31(17-19-11-6-9-14-22(19)28)24(32)15-10-16-30-26(34)20-12-7-8-13-21(20)27(30)35/h6-9,11-14,18,23H,4-5,10,15-17H2,1-3H3,(H,29,33)/t18-,23+/m0/s1 |
| InChIKey | GRZYCIXZUGEMAF-FDDCHVKYSA-N |
| XLogP | 4.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|