C22H26BrN3O4 — CID 100652977
(2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-bromophenyl)methyl]amino]-N-methylpropanamide (PubChem CID 100652977) has the molecular formula C22H26BrN3O4 and a molecular weight of 476.37 g/mol. Its IUPAC name is (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-bromophenyl)methyl]amino]-N-methylpropanamide.
| Compound Name | (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-bromophenyl)methyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 100652977 |
| Molecular Formula | C22H26BrN3O4 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-bromophenyl)methyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](C)N(Cc1ccc(Br)cc1)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C22H26BrN3O4/c1-14(20(28)24-2)26(13-15-7-9-16(23)10-8-15)19(27)11-12-25-21(29)17-5-3-4-6-18(17)22(25)30/h3-4,7-10,14,17-18H,5-6,11-13H2,1-2H3,(H,24,28)/t14-,17-,18+/m0/s1 |
| InChIKey | POALHZNEKPSVHR-JCGIZDLHSA-N |
| XLogP | 2.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|