C26H32FN3O4 — CID 132615389
2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-cyclopentylpropanamide (PubChem CID 132615389) has the molecular formula C26H32FN3O4 and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 132615389 |
| Molecular Formula | C26H32FN3O4 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(4-fluorophenyl)methyl]amino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1ccc(F)cc1)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C26H32FN3O4/c1-17(24(32)28-20-6-2-3-7-20)30(16-18-10-12-19(27)13-11-18)23(31)14-15-29-25(33)21-8-4-5-9-22(21)26(29)34/h4-5,10-13,17,20-22H,2-3,6-9,14-16H2,1H3,(H,28,32)/t17?,21-,22+ |
| InChIKey | RYYGVRKPSWNIGZ-IVXOOFBDSA-N |
| XLogP | 2.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|