C27H33Cl2N3O4 — CID 100500051
(2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 100500051) has the molecular formula C27H33Cl2N3O4 and a molecular weight of 534.48 g/mol. Its IUPAC name is (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 100500051 |
| Molecular Formula | C27H33Cl2N3O4 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C27H33Cl2N3O4/c1-17(25(34)30-19-7-3-2-4-8-19)32(16-18-11-12-22(28)23(29)15-18)24(33)13-14-31-26(35)20-9-5-6-10-21(20)27(31)36/h5-6,11-12,15,17,19-21H,2-4,7-10,13-14,16H2,1H3,(H,30,34)/t17-,20-,21+/m1/s1 |
| InChIKey | XIXBELGYRJJEDO-UIFIKXQLSA-N |
| XLogP | 4.50 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|