C25H31Cl2N3O4 — CID 132727965
2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-tert-butylpropanamide (PubChem CID 132727965) has the molecular formula C25H31Cl2N3O4 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-tert-butylpropanamide.
| Compound Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 132727965 |
| Molecular Formula | C25H31Cl2N3O4 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3,4-dichlorophenyl)methyl]amino]-N-tert-butylpropanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C25H31Cl2N3O4/c1-15(22(32)28-25(2,3)4)30(14-16-9-10-19(26)20(27)13-16)21(31)11-12-29-23(33)17-7-5-6-8-18(17)24(29)34/h5-6,9-10,13,15,17-18H,7-8,11-12,14H2,1-4H3,(H,28,32)/t15?,17-,18+ |
| InChIKey | JVHHUVFQFWKAHX-ZNXRZULTSA-N |
| XLogP | 3.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|