C27H34ClN3O4 — CID 100552589
(2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide (PubChem CID 100552589) has the molecular formula C27H34ClN3O4 and a molecular weight of 500.04 g/mol. Its IUPAC name is (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide.
| Compound Name | (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 100552589 |
| Molecular Formula | C27H34ClN3O4 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (2S)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(3-chlorophenyl)methyl]amino]-N-cyclohexylpropanamide |
| SMILES | C[C@@H](C(=O)NC1CCCCC1)N(Cc1cccc(Cl)c1)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C27H34ClN3O4/c1-18(25(33)29-21-10-3-2-4-11-21)31(17-19-8-7-9-20(28)16-19)24(32)14-15-30-26(34)22-12-5-6-13-23(22)27(30)35/h5-9,16,18,21-23H,2-4,10-15,17H2,1H3,(H,29,33)/t18-,22-,23+/m0/s1 |
| InChIKey | DDXBHUMZLKCCQT-OFAXGOBFSA-N |
| XLogP | 3.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|