C20H19BrN2O3 — CID 8759838
N-[(1S)-1-(2-bromophenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 8759838) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 8759838 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | C[C@H](NC(=O)CCCN1C(=O)c2ccccc2C1=O)c1ccccc1Br |
| InChI | InChI=1S/C20H19BrN2O3/c1-13(14-7-4-5-10-17(14)21)22-18(24)11-6-12-23-19(25)15-8-2-3-9-16(15)20(23)26/h2-5,7-10,13H,6,11-12H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | OXZZYGAPMAGBGB-ZDUSSCGKSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|