C14H14BrN3O4 — CID 7756670
N-[(1S)-1-(2-bromophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7756670) has the molecular formula C14H14BrN3O4 and a molecular weight of 368.19 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7756670 |
| Molecular Formula | C14H14BrN3O4 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)C(=O)N(C)C1=O)c1ccccc1Br |
| InChI | InChI=1S/C14H14BrN3O4/c1-8(9-5-3-4-6-10(9)15)16-11(19)7-18-13(21)12(20)17(2)14(18)22/h3-6,8H,7H2,1-2H3,(H,16,19)/t8-/m0/s1 |
| InChIKey | ZTFSFJRYAFUGAG-QMMMGPOBSA-N |
| XLogP | 1.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|