C14H13Cl2N3O4 — CID 7757106
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide (PubChem CID 7757106) has the molecular formula C14H13Cl2N3O4 and a molecular weight of 358.18 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7757106 |
| Molecular Formula | C14H13Cl2N3O4 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-(3-methyl-2,4,5-trioxoimidazolidin-1-yl)acetamide |
| SMILES | C[C@@H](NC(=O)CN1C(=O)C(=O)N(C)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O4/c1-7(9-4-3-8(15)5-10(9)16)17-11(20)6-19-13(22)12(21)18(2)14(19)23/h3-5,7H,6H2,1-2H3,(H,17,20)/t7-/m1/s1 |
| InChIKey | NTSRQZGZPPEMKI-SSDOTTSWSA-N |
| XLogP | 1.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|