C17H19Cl2N3O3 — CID 4880191
N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 4880191) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 4880191 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC2(CCCC2)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H19Cl2N3O3/c1-10(12-5-4-11(18)8-13(12)19)20-14(23)9-22-15(24)17(21-16(22)25)6-2-3-7-17/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | XUCFVHPIWULEOW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|