C16H17Cl2N3O4 — CID 167746953
N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 167746953) has the molecular formula C16H17Cl2N3O4 and a molecular weight of 386.24 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 167746953 |
| Molecular Formula | C16H17Cl2N3O4 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-2-(2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC2(CCOC2)C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2N3O4/c1-9(11-3-2-10(17)6-12(11)18)19-13(22)7-21-14(23)16(20-15(21)24)4-5-25-8-16/h2-3,6,9H,4-5,7-8H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | WQFVARLLZRUDQH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|