C19H20Cl2N4O4 — CID 41135725
N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 41135725) has the molecular formula C19H20Cl2N4O4 and a molecular weight of 439.30 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 41135725 |
| Molecular Formula | C19H20Cl2N4O4 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | N-[(1S)-1-(2,4-dichlorophenyl)ethyl]-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)N[C@@H](C)c2ccc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C19H20Cl2N4O4/c1-4-8-23-17(27)24(9-5-2)19(29)25(18(23)28)11-16(26)22-12(3)14-7-6-13(20)10-15(14)21/h4-7,10,12H,1-2,8-9,11H2,3H3,(H,22,26)/t12-/m0/s1 |
| InChIKey | KTHUMZJSGALBOM-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|