C18H22N2O5 — CID 19166825
methyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]propanoate (PubChem CID 19166825) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]propanoate.
| Compound Name | methyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]propanoate |
|---|---|
| PubChem CID | 19166825 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | methyl 2-[6-(1,3-dioxoisoindol-2-yl)hexanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O5/c1-12(18(24)25-2)19-15(21)10-4-3-7-11-20-16(22)13-8-5-6-9-14(13)17(20)23/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,19,21) |
| InChIKey | LZOYQLZPVRKFNX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|