C12H12N2O4 — CID 51074410
3-(1,3-dioxoisoindol-2-yl)-N-methoxypropanamide (PubChem CID 51074410) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-methoxypropanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-methoxypropanamide |
|---|---|
| PubChem CID | 51074410 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-methoxypropanamide |
| SMILES | CONC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H12N2O4/c1-18-13-10(15)6-7-14-11(16)8-4-2-3-5-9(8)12(14)17/h2-5H,6-7H2,1H3,(H,13,15) |
| InChIKey | DMKRABBTXAHDIJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|