C22H28N4O3 — CID 19462866
6-(1,3-dioxoisoindol-2-yl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]hexanamide (PubChem CID 19462866) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 19462866 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]hexanamide |
| SMILES | CCn1cc(C(C)NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)c(C)n1 |
| InChI | InChI=1S/C22H28N4O3/c1-4-25-14-19(16(3)24-25)15(2)23-20(27)12-6-5-9-13-26-21(28)17-10-7-8-11-18(17)22(26)29/h7-8,10-11,14-15H,4-6,9,12-13H2,1-3H3,(H,23,27) |
| InChIKey | HXSIASWQKWSFOK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|