C21H24N2O2 — CID 18088905
2-[4-[methyl(1-phenylethyl)amino]butyl]isoindole-1,3-dione (PubChem CID 18088905) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[4-[methyl(1-phenylethyl)amino]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[methyl(1-phenylethyl)amino]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18088905 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[4-[methyl(1-phenylethyl)amino]butyl]isoindole-1,3-dione |
| SMILES | CC(c1ccccc1)N(C)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-16(17-10-4-3-5-11-17)22(2)14-8-9-15-23-20(24)18-12-6-7-13-19(18)21(23)25/h3-7,10-13,16H,8-9,14-15H2,1-2H3 |
| InChIKey | CNAPDMKUWHCCAU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|