C23H21N3O6 — CID 134307088
bis[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid (PubChem CID 134307088) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is bis[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid.
| Compound Name | bis[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
|---|---|
| PubChem CID | 134307088 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | bis[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
| SMILES | O=C(O)N(CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H21N3O6/c27-19-15-7-1-2-8-16(15)20(28)25(19)13-5-11-24(23(31)32)12-6-14-26-21(29)17-9-3-4-10-18(17)22(26)30/h1-4,7-10H,5-6,11-14H2,(H,31,32) |
| InChIKey | LTPHINVTXXMXTA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|