C13H16N2O2 — CID 89296361
2-[3-[bis(trideuteriomethyl)amino]propyl]isoindole-1,3-dione (PubChem CID 89296361) has the molecular formula C13H16N2O2 and a molecular weight of 238.32 g/mol. Its IUPAC name is 2-[3-[bis(trideuteriomethyl)amino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[bis(trideuteriomethyl)amino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89296361 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-[3-[bis(trideuteriomethyl)amino]propyl]isoindole-1,3-dione |
| SMILES | [2H]C([2H])([2H])N(CCCN1C(=O)c2ccccc2C1=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H16N2O2/c1-14(2)8-5-9-15-12(16)10-6-3-4-7-11(10)13(15)17/h3-4,6-7H,5,8-9H2,1-2H3/i1D3,2D3 |
| InChIKey | DYZHJGYWAJRDAJ-WFGJKAKNSA-N |
| XLogP | 1.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|