C13H13NO5 — CID 22795885
(2S)-5-(1,3-dioxoisoindol-2-yl)-2-hydroxypentanoic acid (PubChem CID 22795885) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2S)-5-(1,3-dioxoisoindol-2-yl)-2-hydroxypentanoic acid.
| Compound Name | (2S)-5-(1,3-dioxoisoindol-2-yl)-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 22795885 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2S)-5-(1,3-dioxoisoindol-2-yl)-2-hydroxypentanoic acid |
| SMILES | O=C(O)[C@@H](O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13NO5/c15-10(13(18)19)6-3-7-14-11(16)8-4-1-2-5-9(8)12(14)17/h1-2,4-5,10,15H,3,6-7H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | WTLYOHWTWSCGPD-JTQLQIEISA-N |
| XLogP | 0.51 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|