C27H22ClNO5 — CID 67805260
(2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 67805260) has the molecular formula C27H22ClNO5 and a molecular weight of 475.93 g/mol. Its IUPAC name is (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 67805260 |
| Molecular Formula | C27H22ClNO5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | (2S)-2-[2-[4-(4-chlorophenyl)phenyl]-2-oxoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | O=C(C[C@H](CCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H22ClNO5/c28-21-13-11-18(12-14-21)17-7-9-19(10-8-17)24(30)16-20(27(33)34)4-3-15-29-25(31)22-5-1-2-6-23(22)26(29)32/h1-2,5-14,20H,3-4,15-16H2,(H,33,34)/t20-/m0/s1 |
| InChIKey | OQQJRYZBOKOKHL-FQEVSTJZSA-N |
| XLogP | 5.36 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|