C27H25NO6 — CID 18318983
5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]pentanoic acid (PubChem CID 18318983) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]pentanoic acid.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 18318983 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]pentanoic acid |
| SMILES | O=C(CC(CCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc2c3c(oc2c1)CCCC3 |
| InChI | InChI=1S/C27H25NO6/c29-22(16-11-12-19-18-7-3-4-10-23(18)34-24(19)15-16)14-17(27(32)33)6-5-13-28-25(30)20-8-1-2-9-21(20)26(28)31/h1-2,8-9,11-12,15,17H,3-7,10,13-14H2,(H,32,33) |
| InChIKey | RYNYPTCAJFGVNA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|