C28H27NO5 — CID 70107348
(2R)-5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]pentanoic acid (PubChem CID 70107348) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2R)-5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]pentanoic acid.
| Compound Name | (2R)-5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 70107348 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2R)-5-(1,3-dioxoisoindol-2-yl)-2-[2-oxo-2-(6,7,8,9-tetrahydro-5H-fluoren-2-yl)ethyl]pentanoic acid |
| SMILES | O=C(C[C@@H](CCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc2c(c1)CC1=C2CCCC1 |
| InChI | InChI=1S/C28H27NO5/c30-25(18-11-12-22-20(15-18)14-17-6-1-2-8-21(17)22)16-19(28(33)34)7-5-13-29-26(31)23-9-3-4-10-24(23)27(29)32/h3-4,9-12,15,19H,1-2,5-8,13-14,16H2,(H,33,34)/t19-/m1/s1 |
| InChIKey | RBQPITRTAHDQMG-LJQANCHMSA-N |
| XLogP | 4.92 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|