C26H24N2O6 — CID 54149655
2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 54149655) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 54149655 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | O=NC(CC(CCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc2c3c(oc2c1)CCC3 |
| InChI | InChI=1S/C26H24N2O6/c29-24-19-6-1-2-7-20(19)25(30)28(24)12-4-5-16(26(31)32)13-21(27-33)15-10-11-18-17-8-3-9-22(17)34-23(18)14-15/h1-2,6-7,10-11,14,16,21H,3-5,8-9,12-13H2,(H,31,32) |
| InChIKey | OGVWPQUGMFQLDV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|