C28H28N2O6 — CID 54209382
2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-7-(1,3-dioxoisoindol-2-yl)heptanoic acid (PubChem CID 54209382) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-7-(1,3-dioxoisoindol-2-yl)heptanoic acid.
| Compound Name | 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-7-(1,3-dioxoisoindol-2-yl)heptanoic acid |
|---|---|
| PubChem CID | 54209382 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-nitrosoethyl]-7-(1,3-dioxoisoindol-2-yl)heptanoic acid |
| SMILES | O=NC(CC(CCCCCN1C(=O)c2ccccc2C1=O)C(=O)O)c1ccc2c3c(oc2c1)CCC3 |
| InChI | InChI=1S/C28H28N2O6/c31-26-21-8-3-4-9-22(21)27(32)30(26)14-5-1-2-7-18(28(33)34)15-23(29-35)17-12-13-20-19-10-6-11-24(19)36-25(20)16-17/h3-4,8-9,12-13,16,18,23H,1-2,5-7,10-11,14-15H2,(H,33,34) |
| InChIKey | PUWBBMLGZDKLDJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|