C27H23NO7S — CID 18533191
2-[(4-benzoylphenyl)sulfonylmethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 18533191) has the molecular formula C27H23NO7S and a molecular weight of 505.55 g/mol. Its IUPAC name is 2-[(4-benzoylphenyl)sulfonylmethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | 2-[(4-benzoylphenyl)sulfonylmethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 18533191 |
| Molecular Formula | C27H23NO7S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 2-[(4-benzoylphenyl)sulfonylmethyl]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | O=C(c1ccccc1)c1ccc(S(=O)(=O)CC(CCCN2C(=O)c3ccccc3C2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H23NO7S/c29-24(18-7-2-1-3-8-18)19-12-14-21(15-13-19)36(34,35)17-20(27(32)33)9-6-16-28-25(30)22-10-4-5-11-23(22)26(28)31/h1-5,7-8,10-15,20H,6,9,16-17H2,(H,32,33) |
| InChIKey | OKNZAHMIAUSTEH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|