C25H21ClN2O6S — CID 54443289
(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 54443289) has the molecular formula C25H21ClN2O6S and a molecular weight of 512.97 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 54443289 |
| Molecular Formula | C25H21ClN2O6S |
| Molecular Weight | 512.97 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | O=C(O)[C@H](CCCN1C(=O)c2ccccc2C1=O)NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN2O6S/c26-18-11-7-16(8-12-18)17-9-13-19(14-10-17)35(33,34)27-22(25(31)32)6-3-15-28-23(29)20-4-1-2-5-21(20)24(28)30/h1-2,4-5,7-14,22,27H,3,6,15H2,(H,31,32)/t22-/m0/s1 |
| InChIKey | WPQOWKNXHYOSPG-QFIPXVFZSA-N |
| XLogP | 3.81 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.97 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|