C23H24ClN3O5S — CID 54293775
(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(1-methylpyrrole-2-carbonyl)amino]pentanoic acid (PubChem CID 54293775) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(1-methylpyrrole-2-carbonyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(1-methylpyrrole-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 54293775 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(1-methylpyrrole-2-carbonyl)amino]pentanoic acid |
| SMILES | Cn1cccc1C(=O)NCCC[C@H](NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H24ClN3O5S/c1-27-15-3-5-21(27)22(28)25-14-2-4-20(23(29)30)26-33(31,32)19-12-8-17(9-13-19)16-6-10-18(24)11-7-16/h3,5-13,15,20,26H,2,4,14H2,1H3,(H,25,28)(H,29,30)/t20-/m0/s1 |
| InChIKey | RZIUIWXDJBQOND-FQEVSTJZSA-N |
| XLogP | 3.29 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|