C31H37ClN2O5S — CID 18682789
2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(4-heptylbenzoyl)amino]pentanoic acid (PubChem CID 18682789) has the molecular formula C31H37ClN2O5S and a molecular weight of 585.17 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(4-heptylbenzoyl)amino]pentanoic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(4-heptylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 18682789 |
| Molecular Formula | C31H37ClN2O5S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(4-heptylbenzoyl)amino]pentanoic acid |
| SMILES | CCCCCCCc1ccc(C(=O)NCCCC(NS(=O)(=O)c2ccc(-c3ccc(Cl)cc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H37ClN2O5S/c1-2-3-4-5-6-8-23-10-12-26(13-11-23)30(35)33-22-7-9-29(31(36)37)34-40(38,39)28-20-16-25(17-21-28)24-14-18-27(32)19-15-24/h10-21,29,34H,2-9,22H2,1H3,(H,33,35)(H,36,37) |
| InChIKey | QQFRYIHEBTXPKG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|