C28H29ClN2O7S — CID 18682835
5-[[4-carboxy-4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]butyl]amino]-5-oxo-2-phenylpentanoic acid (PubChem CID 18682835) has the molecular formula C28H29ClN2O7S and a molecular weight of 573.07 g/mol. Its IUPAC name is 5-[[4-carboxy-4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]butyl]amino]-5-oxo-2-phenylpentanoic acid.
| Compound Name | 5-[[4-carboxy-4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]butyl]amino]-5-oxo-2-phenylpentanoic acid |
|---|---|
| PubChem CID | 18682835 |
| Molecular Formula | C28H29ClN2O7S |
| Molecular Weight | 573.07 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 5-[[4-carboxy-4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]butyl]amino]-5-oxo-2-phenylpentanoic acid |
| SMILES | O=C(CCC(C(=O)O)c1ccccc1)NCCCC(NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H29ClN2O7S/c29-22-12-8-19(9-13-22)20-10-14-23(15-11-20)39(37,38)31-25(28(35)36)7-4-18-30-26(32)17-16-24(27(33)34)21-5-2-1-3-6-21/h1-3,5-6,8-15,24-25,31H,4,7,16-18H2,(H,30,32)(H,33,34)(H,35,36) |
| InChIKey | SFQDKZPALHZEET-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.07 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|