C25H22ClF3N2O5S — CID 18682796
2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[4-(trifluoromethyl)benzoyl]amino]pentanoic acid (PubChem CID 18682796) has the molecular formula C25H22ClF3N2O5S and a molecular weight of 554.97 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[4-(trifluoromethyl)benzoyl]amino]pentanoic acid.
| Compound Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[4-(trifluoromethyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18682796 |
| Molecular Formula | C25H22ClF3N2O5S |
| Molecular Weight | 554.97 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[4-(trifluoromethyl)benzoyl]amino]pentanoic acid |
| SMILES | O=C(NCCCC(NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22ClF3N2O5S/c26-20-11-5-16(6-12-20)17-7-13-21(14-8-17)37(35,36)31-22(24(33)34)2-1-15-30-23(32)18-3-9-19(10-4-18)25(27,28)29/h3-14,22,31H,1-2,15H2,(H,30,32)(H,33,34) |
| InChIKey | ZYKITJZXCDJFAM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|