C23H23ClN4O5S — CID 59879555
(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[(E)-3-(4H-imidazol-4-yl)prop-2-enoyl]amino]pentanoic acid (PubChem CID 59879555) has the molecular formula C23H23ClN4O5S and a molecular weight of 502.98 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[(E)-3-(4H-imidazol-4-yl)prop-2-enoyl]amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[(E)-3-(4H-imidazol-4-yl)prop-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59879555 |
| Molecular Formula | C23H23ClN4O5S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[[(E)-3-(4H-imidazol-4-yl)prop-2-enoyl]amino]pentanoic acid |
| SMILES | O=C(/C=C/C1C=NC=N1)NCCC[C@H](NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H23ClN4O5S/c24-18-7-3-16(4-8-18)17-5-10-20(11-6-17)34(32,33)28-21(23(30)31)2-1-13-26-22(29)12-9-19-14-25-15-27-19/h3-12,14-15,19,21,28H,1-2,13H2,(H,26,29)(H,30,31)/b12-9+/t19?,21-/m0/s1 |
| InChIKey | YYYPXLPPIPHMDG-RETJMFIZSA-N |
| XLogP | 2.67 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|