C24H21ClF2N2O5S — CID 54390912
(2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(3,5-difluorobenzoyl)amino]pentanoic acid (PubChem CID 54390912) has the molecular formula C24H21ClF2N2O5S and a molecular weight of 522.96 g/mol. Its IUPAC name is (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(3,5-difluorobenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(3,5-difluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 54390912 |
| Molecular Formula | C24H21ClF2N2O5S |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | (2S)-2-[[4-(4-chlorophenyl)phenyl]sulfonylamino]-5-[(3,5-difluorobenzoyl)amino]pentanoic acid |
| SMILES | O=C(NCCC[C@H](NS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C24H21ClF2N2O5S/c25-18-7-3-15(4-8-18)16-5-9-21(10-6-16)35(33,34)29-22(24(31)32)2-1-11-28-23(30)17-12-19(26)14-20(27)13-17/h3-10,12-14,22,29H,1-2,11H2,(H,28,30)(H,31,32)/t22-/m0/s1 |
| InChIKey | VGOKTHPJRJCCEK-QFIPXVFZSA-N |
| XLogP | 4.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|