C20H24N2O5S — CID 127044139
(2S)-5-oxo-2-[(4-phenylphenyl)sulfonylamino]-5-(propylamino)pentanoic acid (PubChem CID 127044139) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2S)-5-oxo-2-[(4-phenylphenyl)sulfonylamino]-5-(propylamino)pentanoic acid.
| Compound Name | (2S)-5-oxo-2-[(4-phenylphenyl)sulfonylamino]-5-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 127044139 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-5-oxo-2-[(4-phenylphenyl)sulfonylamino]-5-(propylamino)pentanoic acid |
| SMILES | CCCNC(=O)CC[C@H](NS(=O)(=O)c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H24N2O5S/c1-2-14-21-19(23)13-12-18(20(24)25)22-28(26,27)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,18,22H,2,12-14H2,1H3,(H,21,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | NGVKQXNJLILPFW-SFHVURJKSA-N |
| XLogP | 2.39 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |