C18H29N3O4S — CID 7126519
(2R)-2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide (PubChem CID 7126519) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is (2R)-2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide.
| Compound Name | (2R)-2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 7126519 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2R)-2-[(4-methylphenyl)sulfonylamino]-N,N'-dipropylpentanediamide |
| SMILES | CCCNC(=O)CC[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)NCCC |
| InChI | InChI=1S/C18H29N3O4S/c1-4-12-19-17(22)11-10-16(18(23)20-13-5-2)21-26(24,25)15-8-6-14(3)7-9-15/h6-9,16,21H,4-5,10-13H2,1-3H3,(H,19,22)(H,20,23)/t16-/m1/s1 |
| InChIKey | UAGLXGPTHWMFPB-MRXNPFEDSA-N |
| XLogP | 1.47 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |