C12H13Cl2NO4S — CID 71384812
2-[(4-methylphenyl)sulfonylamino]pentanedioyl dichloride (PubChem CID 71384812) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]pentanedioyl dichloride.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]pentanedioyl dichloride |
|---|---|
| PubChem CID | 71384812 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]pentanedioyl dichloride |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCC(=O)Cl)C(=O)Cl)cc1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c1-8-2-4-9(5-3-8)20(18,19)15-10(12(14)17)6-7-11(13)16/h2-5,10,15H,6-7H2,1H3 |
| InChIKey | LBKNGJSUHUEERP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|