C11H14NO4S- — CID 4987554
2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 4987554) has the molecular formula C11H14NO4S- and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 4987554 |
| Molecular Formula | C11H14NO4S- |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H15NO4S/c1-3-10(11(13)14)12-17(15,16)9-6-4-8(2)5-7-9/h4-7,10,12H,3H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | OCFPTFVQZWHPPH-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |