C21H25ClN2O5S — CID 14082524
benzyl N-[(5S)-6-chloro-5-[(4-methylphenyl)sulfonylamino]-6-oxohexyl]carbamate (PubChem CID 14082524) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is benzyl N-[(5S)-6-chloro-5-[(4-methylphenyl)sulfonylamino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-6-chloro-5-[(4-methylphenyl)sulfonylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 14082524 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | benzyl N-[(5S)-6-chloro-5-[(4-methylphenyl)sulfonylamino]-6-oxohexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CCCCNC(=O)OCc2ccccc2)C(=O)Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-16-10-12-18(13-11-16)30(27,28)24-19(20(22)25)9-5-6-14-23-21(26)29-15-17-7-3-2-4-8-17/h2-4,7-8,10-13,19,24H,5-6,9,14-15H2,1H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | YTRBCFIDRVOLRH-IBGZPJMESA-N |
| XLogP | 3.50 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|