C23H30N6O6S — CID 26791358
benzyl N-[N'-[(4R)-5-[(2-amino-2-oxoethyl)amino]-4-[(4-methylphenyl)sulfonylamino]-5-oxopentyl]carbamimidoyl]carbamate (PubChem CID 26791358) has the molecular formula C23H30N6O6S and a molecular weight of 518.60 g/mol. Its IUPAC name is benzyl N-[N'-[(4R)-5-[(2-amino-2-oxoethyl)amino]-4-[(4-methylphenyl)sulfonylamino]-5-oxopentyl]carbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4R)-5-[(2-amino-2-oxoethyl)amino]-4-[(4-methylphenyl)sulfonylamino]-5-oxopentyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 26791358 |
| Molecular Formula | C23H30N6O6S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | benzyl N-[N'-[(4R)-5-[(2-amino-2-oxoethyl)amino]-4-[(4-methylphenyl)sulfonylamino]-5-oxopentyl]carbamimidoyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CCC/N=C(\N)NC(=O)OCc2ccccc2)C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C23H30N6O6S/c1-16-9-11-18(12-10-16)36(33,34)29-19(21(31)27-14-20(24)30)8-5-13-26-22(25)28-23(32)35-15-17-6-3-2-4-7-17/h2-4,6-7,9-12,19,29H,5,8,13-15H2,1H3,(H2,24,30)(H,27,31)(H3,25,26,28,32)/t19-/m1/s1 |
| InChIKey | KUBJKFDFAUISHI-LJQANCHMSA-N |
| XLogP | 0.26 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|