C29H40N6O8S — CID 175765671
2-[[(2S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid (PubChem CID 175765671) has the molecular formula C29H40N6O8S and a molecular weight of 632.74 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 175765671 |
| Molecular Formula | C29H40N6O8S |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-phenylpropanoyl]amino]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](Cc2ccccc2)C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C29H40N6O8S/c1-19-12-14-21(15-13-19)44(41,42)35-27(30)31-16-8-11-22(34-28(40)43-29(2,3)4)26(39)33-23(25(38)32-18-24(36)37)17-20-9-6-5-7-10-20/h5-7,9-10,12-15,22-23H,8,11,16-18H2,1-4H3,(H,32,38)(H,33,39)(H,34,40)(H,36,37)(H3,30,31,35)/t22-,23-/m0/s1 |
| InChIKey | HINDWIMSMUIRQD-GOTSBHOMSA-N |
| XLogP | 1.19 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|