C28H36N6O10S — CID 3774067
5-[[5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-(carboxymethylamino)-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 3774067) has the molecular formula C28H36N6O10S and a molecular weight of 648.70 g/mol. Its IUPAC name is 5-[[5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-(carboxymethylamino)-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[[5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-(carboxymethylamino)-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 3774067 |
| Molecular Formula | C28H36N6O10S |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 5-[[5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-(carboxymethylamino)-1-oxopentan-2-yl]amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCCC(NC(=O)C(CCC(=O)O)NC(=O)OCc2ccccc2)C(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C28H36N6O10S/c1-18-9-11-20(12-10-18)45(42,43)34-27(29)30-15-5-8-21(25(39)31-16-24(37)38)32-26(40)22(13-14-23(35)36)33-28(41)44-17-19-6-3-2-4-7-19/h2-4,6-7,9-12,21-22H,5,8,13-17H2,1H3,(H,31,39)(H,32,40)(H,33,41)(H,35,36)(H,37,38)(H3,29,30,34) |
| InChIKey | NHFDRLCFEQNGPU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 255.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|