C27H30N4O5S — CID 3010413
(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoic acid (PubChem CID 3010413) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoic acid.
| Compound Name | (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 3010413 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCC[C@H](NC(=O)C(c2ccccc2)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-19-14-16-22(17-15-19)37(35,36)31-27(28)29-18-8-13-23(26(33)34)30-25(32)24(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,14-17,23-24H,8,13,18H2,1H3,(H,30,32)(H,33,34)(H3,28,29,31)/t23-/m0/s1 |
| InChIKey | PVVGWDXKXVXJFB-QHCPKHFHSA-N |
| XLogP | 2.77 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|