C29H35N5O7S2 — CID 15518378
benzyl 2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(benzylsulfonylamino)pentanoyl]amino]acetate (PubChem CID 15518378) has the molecular formula C29H35N5O7S2 and a molecular weight of 629.76 g/mol. Its IUPAC name is benzyl 2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(benzylsulfonylamino)pentanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(benzylsulfonylamino)pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 15518378 |
| Molecular Formula | C29H35N5O7S2 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | benzyl 2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(benzylsulfonylamino)pentanoyl]amino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCC[C@@H](NS(=O)(=O)Cc2ccccc2)C(=O)NCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N5O7S2/c1-22-14-16-25(17-15-22)43(39,40)34-29(30)31-18-8-13-26(33-42(37,38)21-24-11-6-3-7-12-24)28(36)32-19-27(35)41-20-23-9-4-2-5-10-23/h2-7,9-12,14-17,26,33H,8,13,18-21H2,1H3,(H,32,36)(H3,30,31,34)/t26-/m1/s1 |
| InChIKey | MRYTWAFELMSGOO-AREMUKBSSA-N |
| XLogP | 1.72 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|