C28H38N6O9S — CID 99638921
methyl (2R,3R)-2-[[2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]-3-hydroxybutanoate (PubChem CID 99638921) has the molecular formula C28H38N6O9S and a molecular weight of 634.71 g/mol. Its IUPAC name is methyl (2R,3R)-2-[[2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]-3-hydroxybutanoate.
| Compound Name | methyl (2R,3R)-2-[[2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 99638921 |
| Molecular Formula | C28H38N6O9S |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | methyl (2R,3R)-2-[[2-[[(2R)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@H](NC(=O)CNC(=O)[C@@H](CCC/N=C(\N)NS(=O)(=O)c1ccc(C)cc1)NC(=O)OCc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C28H38N6O9S/c1-18-11-13-21(14-12-18)44(40,41)34-27(29)30-15-7-10-22(32-28(39)43-17-20-8-5-4-6-9-20)25(37)31-16-23(36)33-24(19(2)35)26(38)42-3/h4-6,8-9,11-14,19,22,24,35H,7,10,15-17H2,1-3H3,(H,31,37)(H,32,39)(H,33,36)(H3,29,30,34)/t19-,22-,24-/m1/s1 |
| InChIKey | KNTSKNRYYBPHED-ZFJSRUIDSA-N |
| XLogP | -0.18 |
| TPSA | 227.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|