C24H39N5O7S — CID 131716234
(2S,3S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 131716234) has the molecular formula C24H39N5O7S and a molecular weight of 541.67 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 131716234 |
| Molecular Formula | C24H39N5O7S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (2S,3S)-2-[[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC/N=C(\N)NS(=O)(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H39N5O7S/c1-7-16(3)19(21(31)32)28-20(30)18(27-23(33)36-24(4,5)6)9-8-14-26-22(25)29-37(34,35)17-12-10-15(2)11-13-17/h10-13,16,18-19H,7-9,14H2,1-6H3,(H,27,33)(H,28,30)(H,31,32)(H3,25,26,29)/t16-,18-,19-/m0/s1 |
| InChIKey | AGTFCSHGRSTXJC-WDSOQIARSA-N |
| XLogP | 1.88 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|