C21H32N4O6S — CID 100967423
(2S)-5-[[(cyclopropylamino)-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 100967423) has the molecular formula C21H32N4O6S and a molecular weight of 468.58 g/mol. Its IUPAC name is (2S)-5-[[(cyclopropylamino)-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-5-[[(cyclopropylamino)-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 100967423 |
| Molecular Formula | C21H32N4O6S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (2S)-5-[[(cyclopropylamino)-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=N/CCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)NC2CC2)cc1 |
| InChI | InChI=1S/C21H32N4O6S/c1-14-7-11-16(12-8-14)32(29,30)25-19(23-15-9-10-15)22-13-5-6-17(18(26)27)24-20(28)31-21(2,3)4/h7-8,11-12,15,17H,5-6,9-10,13H2,1-4H3,(H,24,28)(H,26,27)(H2,22,23,25)/t17-/m0/s1 |
| InChIKey | RMCSGRYWXOPUON-KRWDZBQOSA-N |
| XLogP | 2.14 |
| TPSA | 146.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|