C19H29NO7S2 — CID 87113641
(2S)-4-[3-(4-methylphenyl)sulfonyloxypropylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 87113641) has the molecular formula C19H29NO7S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is (2S)-4-[3-(4-methylphenyl)sulfonyloxypropylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-4-[3-(4-methylphenyl)sulfonyloxypropylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 87113641 |
| Molecular Formula | C19H29NO7S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (2S)-4-[3-(4-methylphenyl)sulfonyloxypropylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCCCSCC[C@H](NC(=O)OC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H29NO7S2/c1-14-6-8-15(9-7-14)29(24,25)26-11-5-12-28-13-10-16(17(21)22)20-18(23)27-19(2,3)4/h6-9,16H,5,10-13H2,1-4H3,(H,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | ODESCCFCRGWZBB-INIZCTEOSA-N |
| XLogP | 3.19 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|