C21H33NO7S — CID 10718113
tert-butyl (4S)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10718113) has the molecular formula C21H33NO7S and a molecular weight of 443.56 g/mol. Its IUPAC name is tert-butyl (4S)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl (4S)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10718113 |
| Molecular Formula | C21H33NO7S |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | tert-butyl (4S)-5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO7S/c1-15-8-11-17(12-9-15)30(25,26)27-14-16(22-19(24)29-21(5,6)7)10-13-18(23)28-20(2,3)4/h8-9,11-12,16H,10,13-14H2,1-7H3,(H,22,24)/t16-/m0/s1 |
| InChIKey | SVAOIUSLIQZGRE-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|