C23H35NO10S — CID 87532215
dimethyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioate (PubChem CID 87532215) has the molecular formula C23H35NO10S and a molecular weight of 517.60 g/mol. Its IUPAC name is dimethyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioate.
| Compound Name | dimethyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioate |
|---|---|
| PubChem CID | 87532215 |
| Molecular Formula | C23H35NO10S |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | dimethyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptanedioate |
| SMILES | COC(=O)CC(CC(CC(=O)OC)OCCOS(=O)(=O)c1ccc(C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35NO10S/c1-16-7-9-19(10-8-16)35(28,29)33-12-11-32-18(15-21(26)31-6)13-17(14-20(25)30-5)24-22(27)34-23(2,3)4/h7-10,17-18H,11-15H2,1-6H3,(H,24,27) |
| InChIKey | YWCYECWYRZNPAA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|