C17H27NO5S — CID 14476731
[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] 4-methylbenzenesulfonate (PubChem CID 14476731) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is [(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14476731 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C17H27NO5S/c1-12(2)15(18-16(19)23-17(4,5)6)11-22-24(20,21)14-9-7-13(3)8-10-14/h7-10,12,15H,11H2,1-6H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | HIHCSJSMQZGBDI-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|