C29H43NO8SSi — CID 102378053
[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] benzoate (PubChem CID 102378053) has the molecular formula C29H43NO8SSi and a molecular weight of 593.82 g/mol. Its IUPAC name is [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] benzoate.
| Compound Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] benzoate |
|---|---|
| PubChem CID | 102378053 |
| Molecular Formula | C29H43NO8SSi |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-4-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](NC(=O)OC(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H43NO8SSi/c1-21-15-17-23(18-16-21)39(33,34)35-19-24(30-27(32)38-28(2,3)4)25(20-36-40(8,9)29(5,6)7)37-26(31)22-13-11-10-12-14-22/h10-18,24-25H,19-20H2,1-9H3,(H,30,32)/t24-,25-/m0/s1 |
| InChIKey | VPCXFHVVISUGOV-DQEYMECFSA-N |
| XLogP | 5.84 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|